Products 2651968-71-5
CAS 2651968-71-5 is the registry number for 3-Cyano-3-methylazetidine-1-sulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-cyano-3-methylazetidine-1-sulfonyl chloride (CAS 2651968-71-5) is a chemical compound with the molecular formula C5H7ClN2O2S and a molecular weight of 194.64 g/mol. IUPAC name: 3-cyano-3-methylazetidine-1-sulfonyl chloride. InChIKey: TYBKMELKQGXSBX-UHFFFAOYSA-N.
| Molecular formula | C5H7ClN2O2S |
|---|---|
| Molecular weight | 194.64 g/mol |
| IUPAC name | 3-cyano-3-methylazetidine-1-sulfonyl chloride |
| InChIKey | TYBKMELKQGXSBX-UHFFFAOYSA-N |
| SMILES | CC1(CN(C1)S(=O)(=O)Cl)C#N |
Computed by PubChem (NCBI)