Products 1245820-90-9
CAS 1245820-90-9 appears in our catalog under these names: 1,3-Dimethyl-1h-pyrazole-5-sulfonyl chloride, 95%, 1,3-Dimethyl-1H-pyrazole-5-sulfonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
2,5-dimethylpyrazole-3-sulfonyl chloride (CAS 1245820-90-9) is a chemical compound with the molecular formula C5H7ClN2O2S and a molecular weight of 194.64 g/mol. IUPAC name: 2,5-dimethylpyrazole-3-sulfonyl chloride. InChIKey: FYLQOSUXOCPQGB-UHFFFAOYSA-N.
| Molecular formula | C5H7ClN2O2S |
|---|---|
| Molecular weight | 194.64 g/mol |
| IUPAC name | 2,5-dimethylpyrazole-3-sulfonyl chloride |
| InChIKey | FYLQOSUXOCPQGB-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1)S(=O)(=O)Cl)C |
Computed by PubChem (NCBI)