CAS 2039-06-7 appears in our catalog under these names: 3,5-Diphenyl-4H-1,2,4-triazole, 98%, 98%, 3,5-Diphenyl-4H-1,2,4-triazole, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
3,5-diphenyl-1H-1,2,4-triazole (CAS 2039-06-7) is a chemical compound with the molecular formula C14H11N3 and a molecular weight of 221.26 g/mol. IUPAC name: 3,5-diphenyl-1H-1,2,4-triazole. InChIKey: KPKQWXGFEKRQQA-UHFFFAOYSA-N.
| Molecular formula | C14H11N3 |
|---|---|
| Molecular weight | 221.26 g/mol |
| IUPAC name | 3,5-diphenyl-1H-1,2,4-triazole |
| InChIKey | KPKQWXGFEKRQQA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NN2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)