Products 2039-06-7

CAS 2039-06-7 is the registry number for 3,5-Diphenyl-4H-1,2,4-triazole, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.

Structural formula: {0} (CAS {1})

3,5-diphenyl-1H-1,2,4-triazole (CAS 2039-06-7) is a chemical compound with the molecular formula C14H11N3 and a molecular weight of 221.26 g/mol. IUPAC name: 3,5-diphenyl-1H-1,2,4-triazole. InChIKey: KPKQWXGFEKRQQA-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11N3
Molecular weight221.26 g/mol
IUPAC name3,5-diphenyl-1H-1,2,4-triazole
InChIKeyKPKQWXGFEKRQQA-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=NC(=NN2)C3=CC=CC=C3

Computed by PubChem (NCBI)