3,6-Di(furan-2-yl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione, 97%
cas: 88949-34-2 — see every product listed under this CAS number, including other names
3,6-Di(furan-2-yl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione, 97% (CAS 88949-34-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A659025-250mg |
| cas | 88949-34-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 242.44 Pln | |
| Ambeed | 1g | 459.38 Pln | |
| Ambeed | 5g | 1432.81 Pln | |
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 1g | 362.00 Pln | |
| Chemat | 5g | 1134.80 Pln | |
| BLDpharm | 100mg | 197.73 Pln | |
| BLDpharm | 250mg | 247.72 Pln | |
| BLDpharm | 1g | 492.07 Pln | |
| BLDpharm | 5g | 1541.70 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
1,4-bis(furan-2-yl)-3-hydroxy-2H-pyrrolo[3,4-c]pyrrol-6-one (CAS 88949-34-2) is a chemical compound with the molecular formula C14H8N2O4 and a molecular weight of 268.22 g/mol. IUPAC name: 1,4-bis(furan-2-yl)-3-hydroxy-2H-pyrrolo[3,4-c]pyrrol-6-one. InChIKey: IJIRODYRIBCKOV-UHFFFAOYSA-N.
| Molecular formula | C14H8N2O4 |
|---|---|
| Molecular weight | 268.22 g/mol |
| IUPAC name | 1,4-bis(furan-2-yl)-3-hydroxy-2H-pyrrolo[3,4-c]pyrrol-6-one |
| InChIKey | IJIRODYRIBCKOV-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=C3C(=C(N2)O)C(=NC3=O)C4=CC=CO4 |
Computed by PubChem (NCBI)
Synonyms:
3,6-di(furan-2-yl)pyrrolo[3,4-c]pyrrole-1,4(2H,5H)-dione, 3,6-Di(furan-2-yl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione, 3,6-bis(furan-2-yl)-1H,2H,4H,5H-pyrrolo[3,4-c]pyrrole-1,4-dione, XTIIKFYNACJNAI-UHFFFAOYSA-N, 3,6-Di(2-furyl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione, 1,4-bis(2-furyl)-2,5-dihydropyrrolo[3,4-c]pyrrole-3,6-dione