Products 1410664-43-5

CAS 1410664-43-5 is the registry number for 4-(1,3-Dioxo-1,3-dihydro-2h-pyrrolo[3,4-c]pyridin-2-yl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)benzoic acid (CAS 1410664-43-5) is a chemical compound with the molecular formula C14H8N2O4 and a molecular weight of 268.22 g/mol. IUPAC name: 4-(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)benzoic acid. InChIKey: BXWMCQDVNJDZMW-UHFFFAOYSA-N.

Identity
Molecular formulaC14H8N2O4
Molecular weight268.22 g/mol
IUPAC name4-(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)benzoic acid
InChIKeyBXWMCQDVNJDZMW-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C(=O)O)N2C(=O)C3=C(C2=O)C=NC=C3

Computed by PubChem (NCBI)