Products 57709-61-2
CAS 57709-61-2 appears in our catalog under these names: 1,10–Phenanthroline–2,9–dicarboxylic acid, 1,10-Phenanthroline-2,9-dicarboxylic acid hydrate, 97% , 1,10-Phenanthroline-2,9-dicarboxylic acid 95%, 1,10-Phenanthroline-2,9-dicarboxylic acid, 95%, 95%, 1,10-Phenanthroline-2,9-dicarboxylic acid, 95%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 0.25g, 100g, 100mg, 250mg, 10g.
1,10-phenanthroline-2,9-dicarboxylic acid (CAS 57709-61-2) is a chemical compound with the molecular formula C14H8N2O4 and a molecular weight of 268.22 g/mol. IUPAC name: 1,10-phenanthroline-2,9-dicarboxylic acid. InChIKey: FXSVCROWUPWXBP-UHFFFAOYSA-N.
| Molecular formula | C14H8N2O4 |
|---|---|
| Molecular weight | 268.22 g/mol |
| IUPAC name | 1,10-phenanthroline-2,9-dicarboxylic acid |
| InChIKey | FXSVCROWUPWXBP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C3=C1C=CC(=N3)C(=O)O)N=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
1,10-phenanthroline-2,9-dicarboxylic Acid, 1,10-Phenanthroline-2,9-dicarboxylicacid, [1,10]phenanthroline-2,9-dicarboxylic acid, 2,9-dicarboxy-1,10-phenanthroline, 1,10-phenanthrol, 2,9-Dicarboxylicacid-1,10-phenanthroline, pyridino[3,2-h]quinoline-2,9-dicarboxylic acid, 1,?10-?Phenanthroline-?2,?9-?dicarboxylic acid