CAS 1409198-11-3 is the registry number for 3-(1,3-Dioxo-1,3-dihydro-2h-pyrrolo[3,4-c]pyridin-2-yl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
3-(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)benzoic acid (CAS 1409198-11-3) is a chemical compound with the molecular formula C14H8N2O4 and a molecular weight of 268.22 g/mol. IUPAC name: 3-(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)benzoic acid. InChIKey: PTDRRDIBIYOBER-UHFFFAOYSA-N.
| Molecular formula | C14H8N2O4 |
|---|---|
| Molecular weight | 268.22 g/mol |
| IUPAC name | 3-(1,3-dioxopyrrolo[3,4-c]pyridin-2-yl)benzoic acid |
| InChIKey | PTDRRDIBIYOBER-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N2C(=O)C3=C(C2=O)C=NC=C3)C(=O)O |
Computed by PubChem (NCBI)