CAS 36647-25-3 appears in our catalog under these names: 2-(3-Nitrophenyl)-2,3-dihydro-1h-isoindole-1,3-dione, 95%, 2-(3-Nitrophenyl)-2,3-dihydro-1H-isoindole-1,3-dione. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
2-(3-nitrophenyl)isoindole-1,3-dione (CAS 36647-25-3) is a chemical compound with the molecular formula C14H8N2O4 and a molecular weight of 268.22 g/mol. IUPAC name: 2-(3-nitrophenyl)isoindole-1,3-dione. InChIKey: SREHWIURBJQDOE-UHFFFAOYSA-N.
| Molecular formula | C14H8N2O4 |
|---|---|
| Molecular weight | 268.22 g/mol |
| IUPAC name | 2-(3-nitrophenyl)isoindole-1,3-dione |
| InChIKey | SREHWIURBJQDOE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)C3=CC(=CC=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)