CAS 749230-37-3 appears in our catalog under these names: 3,6-Difluoro-2-hydroxybenzoic acid, 96%, 3,6-Difluoro-2-hydroxybenzoic acid methyl ester, 3,6-Difluoro-2-hydroxybenzoic acid 98%, 3,6-Difluoro-2-hydroxybenzoic acid, 98%, 98%, 3,6-Difluoro-2-hydroxybenzoic acid, ≥95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 2g, 10g, 250mg.
3,6-difluoro-2-hydroxybenzoic acid (CAS 749230-37-3) is a chemical compound with the molecular formula C7H4F2O3 and a molecular weight of 174.10 g/mol. IUPAC name: 3,6-difluoro-2-hydroxybenzoic acid. InChIKey: FZHSZDCTILICIX-UHFFFAOYSA-N.
| Molecular formula | C7H4F2O3 |
|---|---|
| Molecular weight | 174.10 g/mol |
| IUPAC name | 3,6-difluoro-2-hydroxybenzoic acid |
| InChIKey | FZHSZDCTILICIX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)C(=O)O)O)F |
Computed by PubChem (NCBI)