cas: 108238-41-1 — see every product listed under this CAS number, including other names
3,6-Dihydroxyflavone, 98.06% (CAS 108238-41-1) is a chemical reagent available from Chemat. Available pack sizes: 100 mg, 5 mg, 25 mg, 10 mg, 50 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-N8481-100 mg |
| cas | 108238-41-1 |
| size | 100 mg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 mg | 909.48 Pln | |
| MedChemExpress | 5 mg | 240.74 Pln | |
| MedChemExpress | 25 mg | 472.94 Pln | |
| MedChemExpress | 10 mg | 296.47 Pln | |
| MedChemExpress | 50 mg | 654.06 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 98.06% |
3,6-dihydroxy-2-phenylchromen-4-one (CAS 108238-41-1) is a chemical compound with the molecular formula C15H10O4 and a molecular weight of 254.24 g/mol. IUPAC name: 3,6-dihydroxy-2-phenylchromen-4-one. InChIKey: XHLOLFKZCUCROE-UHFFFAOYSA-N.
| Molecular formula | C15H10O4 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | 3,6-dihydroxy-2-phenylchromen-4-one |
| InChIKey | XHLOLFKZCUCROE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=O)C3=C(O2)C=CC(=C3)O)O |
Computed by PubChem (NCBI)