CAS 602-63-1 appears in our catalog under these names: 1,2-Dihydroxy-3-methylanthraquinone, 95%, 1,2-Dihydroxy-3-methylanthracene-9,10-dione, 97%, 1,2-Dihydroxy-3-methylanthraquinone, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 100mg, 250mg.
1,2-dihydroxy-3-methylanthracene-9,10-dione (CAS 602-63-1) is a chemical compound with the molecular formula C15H10O4 and a molecular weight of 254.24 g/mol. IUPAC name: 1,2-dihydroxy-3-methylanthracene-9,10-dione. InChIKey: QPAGCTACMMYJIO-UHFFFAOYSA-N.
| Molecular formula | C15H10O4 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | 1,2-dihydroxy-3-methylanthracene-9,10-dione |
| InChIKey | QPAGCTACMMYJIO-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1O)O)C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)