CAS 6068-76-4 appears in our catalog under these names: 3,2'-Dihydroxyflavone, 97%, 3,2'-Dihydroxyflavone, >95% (HPLC), 2',3-Dihydroxyflavone, 97% , 2'-Hydroxyflavonol, 2',3-Dihydroxyflavone 97%. Offered by: Combi-blocks, TRC, Thermo Scientific (Alfa Aesar), Biosynth, Ambeed. Available pack sizes: 1g, 5g, 100mg, 500mg, 50mg, 1000mg, 2000mg, 250mg.
3-hydroxy-2-(2-hydroxyphenyl)chromen-4-one (CAS 6068-76-4) is a chemical compound with the molecular formula C15H10O4 and a molecular weight of 254.24 g/mol. IUPAC name: 3-hydroxy-2-(2-hydroxyphenyl)chromen-4-one. InChIKey: VECGDSZOFMYGAF-UHFFFAOYSA-N.
| Molecular formula | C15H10O4 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | 3-hydroxy-2-(2-hydroxyphenyl)chromen-4-one |
| InChIKey | VECGDSZOFMYGAF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=C(C(=O)C3=CC=CC=C3O2)O)O |
Computed by PubChem (NCBI)