CAS 6674-39-1 appears in our catalog under these names: 5,2'-Dihydroxyflavone, 95%, 5,2'-Dihydroxyflavone, 5,2'-Dihydroxyflavone, min. 95 %, 50 mg, 5,2'-Dihydroxyflavone, min. 95 %, 100 mg, 5,2'-Dihydroxyflavone, min. 95 %, 250 mg. Offered by: Combi-blocks, Biosynth, Roth. Available pack sizes: 1g, 25g, 10g, 5g, 100mg, 50mg, 250mg, 500mg.
5-hydroxy-2-(2-hydroxyphenyl)chromen-4-one (CAS 6674-39-1) is a chemical compound with the molecular formula C15H10O4 and a molecular weight of 254.24 g/mol. IUPAC name: 5-hydroxy-2-(2-hydroxyphenyl)chromen-4-one. InChIKey: QAGGRDVXPIXVDQ-UHFFFAOYSA-N.
| Molecular formula | C15H10O4 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | 5-hydroxy-2-(2-hydroxyphenyl)chromen-4-one |
| InChIKey | QAGGRDVXPIXVDQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=O)C3=C(C=CC=C3O2)O)O |
Computed by PubChem (NCBI)