CAS 6665-67-4 appears in our catalog under these names: 4',5–Dihydroxyflavone, 4',5-Dihydroxyflavone, 4',5-Dihydroxyflavone, 95%, 4',5-Dihydroxyflavone, 98+%, 4',5-Dihydroxyflavone, 99.95%. Offered by: GLPBio, Biosynth, Combi-blocks, AmBeed, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 100mg, 500mg, 1g.
5-hydroxy-2-(4-hydroxyphenyl)chromen-4-one (CAS 6665-67-4) is a chemical compound with the molecular formula C15H10O4 and a molecular weight of 254.24 g/mol. IUPAC name: 5-hydroxy-2-(4-hydroxyphenyl)chromen-4-one. InChIKey: OKRNDQLCMXUCGG-UHFFFAOYSA-N.
| Molecular formula | C15H10O4 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | 5-hydroxy-2-(4-hydroxyphenyl)chromen-4-one |
| InChIKey | OKRNDQLCMXUCGG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)OC(=CC2=O)C3=CC=C(C=C3)O)O |
Computed by PubChem (NCBI)