3,6-Dimethyl-9H-carbazole, 99%, 99%
cas: 5599-50-8 — see every product listed under this CAS number, including other names
3,6-Dimethyl-9H-carbazole, 99%, 99% (CAS 5599-50-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11480W-100mg |
| cas | 5599-50-8 |
| size | 100mg |
| availability | 1000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 318.80 Pln | |
| Chemat | 10g | 544.40 Pln | |
| Chemat | 25g | 1115.60 Pln | |
| Chemat | 100g | 3534.80 Pln | |
| Chemat | 250g | 7437.20 Pln | |
| Chemat | 500g | 13416.00 Pln | |
| Chemat | 1kg | 24539.60 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
3,6-dimethyl-9H-carbazole (CAS 5599-50-8) is a chemical compound with the molecular formula C14H13N and a molecular weight of 195.26 g/mol. IUPAC name: 3,6-dimethyl-9H-carbazole. InChIKey: HNACKJNPFWWEKI-UHFFFAOYSA-N.
| Molecular formula | C14H13N |
|---|---|
| Molecular weight | 195.26 g/mol |
| IUPAC name | 3,6-dimethyl-9H-carbazole |
| InChIKey | HNACKJNPFWWEKI-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)NC3=C2C=C(C=C3)C |
Computed by PubChem (NCBI)