Products 5599-50-8
CAS 5599-50-8 appears in our catalog under these names: 3,6–Dimethylcarbazole, 3,6-Dimethylcarbazole, >98.0%(GC), 3,6-Dimethyl-9H-carbazole 95%, 3,6-Dimethyl-9H-carbazole, 99%, 99%, 3,6-Dimethyl-9H-carbazole, 97%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 25g, 100g, 10g, 250g.
3,6-dimethyl-9H-carbazole (CAS 5599-50-8) is a chemical compound with the molecular formula C14H13N and a molecular weight of 195.26 g/mol. IUPAC name: 3,6-dimethyl-9H-carbazole. InChIKey: HNACKJNPFWWEKI-UHFFFAOYSA-N.
| Molecular formula | C14H13N |
|---|---|
| Molecular weight | 195.26 g/mol |
| IUPAC name | 3,6-dimethyl-9H-carbazole |
| InChIKey | HNACKJNPFWWEKI-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)NC3=C2C=C(C=C3)C |
Computed by PubChem (NCBI)