3,8-Dimethyl-4,7-phenanthroline, 97%
cas: 36749-63-0 — see every product listed under this CAS number, including other names
3,8-Dimethyl-4,7-phenanthroline, 97% (CAS 36749-63-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 50mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A239132-250mg |
| cas | 36749-63-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1610.81 Pln | |
| Ambeed | 1g | 4720.25 Pln | |
| Chemat | 100mg | 611.60 Pln | |
| Chemat | 250mg | 1182.80 Pln | |
| Chemat | 1g | 3438.80 Pln | |
| BLDpharm | 50mg | 564.27 Pln | |
| BLDpharm | 100mg | 891.93 Pln | |
| BLDpharm | 250mg | 1730.53 Pln | |
| BLDpharm | 1g | 5084.90 Pln | |
| Fluorochem | 100mg | 851.80 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
3,8-dimethyl-4,7-phenanthroline (CAS 36749-63-0) is a chemical compound with the molecular formula C14H12N2 and a molecular weight of 208.26 g/mol. IUPAC name: 3,8-dimethyl-4,7-phenanthroline. InChIKey: CODTWXNXJPQQOB-UHFFFAOYSA-N.
| Molecular formula | C14H12N2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | 3,8-dimethyl-4,7-phenanthroline |
| InChIKey | CODTWXNXJPQQOB-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)C3=C(C=C2)N=C(C=C3)C |
Computed by PubChem (NCBI)