CAS 36749-63-0 is the registry number for 3,8-Dimethyl-4,7-phenanthroline, 97%. Offered by: Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
3,8-dimethyl-4,7-phenanthroline (CAS 36749-63-0) is a chemical compound with the molecular formula C14H12N2 and a molecular weight of 208.26 g/mol. IUPAC name: 3,8-dimethyl-4,7-phenanthroline. InChIKey: CODTWXNXJPQQOB-UHFFFAOYSA-N.
| Molecular formula | C14H12N2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | 3,8-dimethyl-4,7-phenanthroline |
| InChIKey | CODTWXNXJPQQOB-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)C3=C(C=C2)N=C(C=C3)C |
Computed by PubChem (NCBI)