cas: 67098-56-0 — see every product listed under this CAS number, including other names
3- tert -Butoxycarbonylamino-2-phenyl-propionic acid, 97% (CAS 67098-56-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F031856-250MG |
| cas | 67098-56-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 320.74 Pln | |
| Fluorochem | 1g | 659.16 Pln | |
| Fluorochem | 5g | 1872.28 Pln | |
| Fluorochem | 10g | 3215.55 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylpropanoic acid (CAS 67098-56-0) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 265.30 g/mol. IUPAC name: 3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylpropanoic acid. InChIKey: PZRXRMWHLUUHFB-UHFFFAOYSA-N.
| Molecular formula | C14H19NO4 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylpropanoic acid |
| InChIKey | PZRXRMWHLUUHFB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC(C1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)