cas: 838818-53-4 — see every product listed under this CAS number, including other names
3-((2,3,5,6-Tetramethylphenyl)sulfonamido)benzoic acid, 97% (CAS 838818-53-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A821658-100mg |
| cas | 838818-53-4 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 102.55 Pln | |
| AmBeed | 250mg | 148.12 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-[(2,3,5,6-tetramethylphenyl)sulfonylamino]benzoic acid (CAS 838818-53-4) is a chemical compound with the molecular formula C17H19NO4S and a molecular weight of 333.4 g/mol. IUPAC name: 3-[(2,3,5,6-tetramethylphenyl)sulfonylamino]benzoic acid. InChIKey: YLYTXIQORGJGNT-UHFFFAOYSA-N.
| Molecular formula | C17H19NO4S |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | 3-[(2,3,5,6-tetramethylphenyl)sulfonylamino]benzoic acid |
| InChIKey | YLYTXIQORGJGNT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C)S(=O)(=O)NC2=CC=CC(=C2)C(=O)O)C)C |
Computed by PubChem (NCBI)