CAS 838818-53-4 appears in our catalog under these names: 3-(2,3,5,6-Tetramethylphenylsulfonamido)benzoic acid, 95%, 3-((2,3,5,6-Tetramethylphenyl)sulfonamido)benzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg.
3-[(2,3,5,6-tetramethylphenyl)sulfonylamino]benzoic acid (CAS 838818-53-4) is a chemical compound with the molecular formula C17H19NO4S and a molecular weight of 333.4 g/mol. IUPAC name: 3-[(2,3,5,6-tetramethylphenyl)sulfonylamino]benzoic acid. InChIKey: YLYTXIQORGJGNT-UHFFFAOYSA-N.
| Molecular formula | C17H19NO4S |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | 3-[(2,3,5,6-tetramethylphenyl)sulfonylamino]benzoic acid |
| InChIKey | YLYTXIQORGJGNT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C)S(=O)(=O)NC2=CC=CC(=C2)C(=O)O)C)C |
Computed by PubChem (NCBI)