Products 401605-12-7

CAS 401605-12-7 is the registry number for N-(2,4-Dimethylphenyl)-n-[(4-methylphenyl)sulfonyl]glycine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(2,4-dimethyl-N-(4-methylphenyl)sulfonylanilino)acetic acid (CAS 401605-12-7) is a chemical compound with the molecular formula C17H19NO4S and a molecular weight of 333.4 g/mol. IUPAC name: 2-(2,4-dimethyl-N-(4-methylphenyl)sulfonylanilino)acetic acid. InChIKey: IMPXUJGBTMLICL-UHFFFAOYSA-N.

Identity
Molecular formulaC17H19NO4S
Molecular weight333.4 g/mol
IUPAC name2-(2,4-dimethyl-N-(4-methylphenyl)sulfonylanilino)acetic acid
InChIKeyIMPXUJGBTMLICL-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)N(CC(=O)O)C2=C(C=C(C=C2)C)C

Computed by PubChem (NCBI)