Products 730249-87-3

CAS 730249-87-3 is the registry number for 4-(2,3,5,6-Tetramethylphenylsulfonylamino)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

4-[(2,3,5,6-tetramethylphenyl)sulfonylamino]benzoic acid (CAS 730249-87-3) is a chemical compound with the molecular formula C17H19NO4S and a molecular weight of 333.4 g/mol. IUPAC name: 4-[(2,3,5,6-tetramethylphenyl)sulfonylamino]benzoic acid. InChIKey: GXRBZEBVKOIXDU-UHFFFAOYSA-N.

Identity
Molecular formulaC17H19NO4S
Molecular weight333.4 g/mol
IUPAC name4-[(2,3,5,6-tetramethylphenyl)sulfonylamino]benzoic acid
InChIKeyGXRBZEBVKOIXDU-UHFFFAOYSA-N
SMILESCC1=CC(=C(C(=C1C)S(=O)(=O)NC2=CC=C(C=C2)C(=O)O)C)C

Computed by PubChem (NCBI)