CAS 730249-87-3 is the registry number for 4-(2,3,5,6-Tetramethylphenylsulfonylamino)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-[(2,3,5,6-tetramethylphenyl)sulfonylamino]benzoic acid (CAS 730249-87-3) is a chemical compound with the molecular formula C17H19NO4S and a molecular weight of 333.4 g/mol. IUPAC name: 4-[(2,3,5,6-tetramethylphenyl)sulfonylamino]benzoic acid. InChIKey: GXRBZEBVKOIXDU-UHFFFAOYSA-N.
| Molecular formula | C17H19NO4S |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | 4-[(2,3,5,6-tetramethylphenyl)sulfonylamino]benzoic acid |
| InChIKey | GXRBZEBVKOIXDU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C)S(=O)(=O)NC2=CC=C(C=C2)C(=O)O)C)C |
Computed by PubChem (NCBI)