Products 884987-72-8

CAS 884987-72-8 is the registry number for N-(4-Ethylphenyl)-n-[(4-methylphenyl)sulfonyl]glycine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(4-ethyl-N-(4-methylphenyl)sulfonylanilino)acetic acid (CAS 884987-72-8) is a chemical compound with the molecular formula C17H19NO4S and a molecular weight of 333.4 g/mol. IUPAC name: 2-(4-ethyl-N-(4-methylphenyl)sulfonylanilino)acetic acid. InChIKey: KSUZERKANNRDIO-UHFFFAOYSA-N.

Identity
Molecular formulaC17H19NO4S
Molecular weight333.4 g/mol
IUPAC name2-(4-ethyl-N-(4-methylphenyl)sulfonylanilino)acetic acid
InChIKeyKSUZERKANNRDIO-UHFFFAOYSA-N
SMILESCCC1=CC=C(C=C1)N(CC(=O)O)S(=O)(=O)C2=CC=C(C=C2)C

Computed by PubChem (NCBI)