cas: 790271-01-1 — see every product listed under this CAS number, including other names
3-(1-(2-Cyanoethyl)-1H-indol-3-yl)prop-2-enoic acid, 95% (CAS 790271-01-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1011150-10g |
| cas | 790271-01-1 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 17842.30 Pln | |
| AmBeed | 5g | 11495.05 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
(E)-3-[1-(2-cyanoethyl)indol-3-yl]prop-2-enoic acid (CAS 790271-01-1) is a chemical compound with the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. IUPAC name: (E)-3-[1-(2-cyanoethyl)indol-3-yl]prop-2-enoic acid. InChIKey: UJSPGFDSPNNZFP-VOTSOKGWSA-N.
| Molecular formula | C14H12N2O2 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | (E)-3-[1-(2-cyanoethyl)indol-3-yl]prop-2-enoic acid |
| InChIKey | UJSPGFDSPNNZFP-VOTSOKGWSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2CCC#N)/C=C/C(=O)O |
Computed by PubChem (NCBI)