cas: 1190968-78-5 — see every product listed under this CAS number, including other names
3-(1-(P-tolyl)ethyl)benzaldehyde (CAS 1190968-78-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F633353-1G |
| cas | 1190968-78-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 7562.98 Pln | |
| Fluorochem | 5g | 22557.70 Pln |
| delivery time | 3-4 weeks |
|---|
3-[1-(4-methylphenyl)ethyl]benzaldehyde (CAS 1190968-78-5) is a chemical compound with the molecular formula C16H16O and a molecular weight of 224.30 g/mol. IUPAC name: 3-[1-(4-methylphenyl)ethyl]benzaldehyde. InChIKey: XCIDTICCZNQSOD-UHFFFAOYSA-N.
| Molecular formula | C16H16O |
|---|---|
| Molecular weight | 224.30 g/mol |
| IUPAC name | 3-[1-(4-methylphenyl)ethyl]benzaldehyde |
| InChIKey | XCIDTICCZNQSOD-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(C)C2=CC=CC(=C2)C=O |
Computed by PubChem (NCBI)