cas: 2095410-90-3 — see every product listed under this CAS number, including other names
3-(1H-Pyrazol-4-yl)piperidine dihydrochloride, 97% (CAS 2095410-90-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 100mg, 250mg, 500mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A1188684-10g |
| cas | 2095410-90-3 |
| size | 10g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 42046.48 Pln | |
| AmBeed | 5g | 30029.02 Pln | |
| Fluorochem | 100mg | 1648.40 Pln | |
| Fluorochem | 250mg | 2569.95 Pln | |
| Fluorochem | 500mg | 4173.55 Pln | |
| Fluorochem | 1g | 6224.91 Pln | |
| Fluorochem | 5g | 18147.79 Pln | |
| Fluorochem | 10g | 30195.64 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-(1H-pyrazol-4-yl)piperidine;dihydrochloride (CAS 2095410-90-3) is a chemical compound with the molecular formula C8H15Cl2N3 and a molecular weight of 224.13 g/mol. IUPAC name: 3-(1H-pyrazol-4-yl)piperidine;dihydrochloride. InChIKey: UUCIQSIENLWQIV-UHFFFAOYSA-N.
| Molecular formula | C8H15Cl2N3 |
|---|---|
| Molecular weight | 224.13 g/mol |
| IUPAC name | 3-(1H-pyrazol-4-yl)piperidine;dihydrochloride |
| InChIKey | UUCIQSIENLWQIV-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)C2=CNN=C2.Cl.Cl |
Computed by PubChem (NCBI)