CAS 1269151-25-8 appears in our catalog under these names: 2-(4,6-Dimethylpyrimidin-2-yl)ethan-1-amine dihydrochloride, 95%, 2-(4,6-Dimethylpyrimidin-2-yl)ethan-1-amine dihydrochloride, 2-(4,6-Dimethylpyrimidin-2-yl)ethanamine dihydrochloride 95%. Offered by: Combi-blocks, Biosynth, Ambeed. Available pack sizes: 10g, 5g, 25g, 250mg, 1g, 2,5g, 100mg.
2-(4,6-dimethylpyrimidin-2-yl)ethanamine;dihydrochloride (CAS 1269151-25-8) is a chemical compound with the molecular formula C8H15Cl2N3 and a molecular weight of 224.13 g/mol. IUPAC name: 2-(4,6-dimethylpyrimidin-2-yl)ethanamine;dihydrochloride. InChIKey: OJRWCSICABUHDF-UHFFFAOYSA-N.
| Molecular formula | C8H15Cl2N3 |
|---|---|
| Molecular weight | 224.13 g/mol |
| IUPAC name | 2-(4,6-dimethylpyrimidin-2-yl)ethanamine;dihydrochloride |
| InChIKey | OJRWCSICABUHDF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)CCN)C.Cl.Cl |
Computed by PubChem (NCBI)