CAS 2095410-90-3 appears in our catalog under these names: 3-(1H-Pyrazol-4-yl)piperidine dihydrochloride, 95%, 3-(1H-Pyrazol-4-yl)piperidine dihydrochloride, 97%, 3-(1H-Pyrazol-4-yl)piperidine dihydrochloride, 97%, 97%. Offered by: Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg, 500mg.
3-(1H-pyrazol-4-yl)piperidine;dihydrochloride (CAS 2095410-90-3) is a chemical compound with the molecular formula C8H15Cl2N3 and a molecular weight of 224.13 g/mol. IUPAC name: 3-(1H-pyrazol-4-yl)piperidine;dihydrochloride. InChIKey: UUCIQSIENLWQIV-UHFFFAOYSA-N.
| Molecular formula | C8H15Cl2N3 |
|---|---|
| Molecular weight | 224.13 g/mol |
| IUPAC name | 3-(1H-pyrazol-4-yl)piperidine;dihydrochloride |
| InChIKey | UUCIQSIENLWQIV-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)C2=CNN=C2.Cl.Cl |
Computed by PubChem (NCBI)