CAS 424837-34-3 is the registry number for 4-Ethyl-4,5,6,7-tetrahydro-3h-imidazo[4,5-c]pyridine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
4-ethyl-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine;dihydrochloride (CAS 424837-34-3) is a chemical compound with the molecular formula C8H15Cl2N3 and a molecular weight of 224.13 g/mol. IUPAC name: 4-ethyl-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine;dihydrochloride. InChIKey: OEPNPAPWGDISPL-UHFFFAOYSA-N.
| Molecular formula | C8H15Cl2N3 |
|---|---|
| Molecular weight | 224.13 g/mol |
| IUPAC name | 4-ethyl-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine;dihydrochloride |
| InChIKey | OEPNPAPWGDISPL-UHFFFAOYSA-N |
| SMILES | CCC1C2=C(CCN1)NC=N2.Cl.Cl |
Computed by PubChem (NCBI)