CAS 1210765-92-6 appears in our catalog under these names: 2-N-(Propan-2-yl)pyridine-2,5-diamine dihydrochloride, 95%, N2-Isopropylpyridine-2,5-diamine hydrochloride, 95+%, 2-N-(Propan-2-yl)pyridine-2,5-diamine dihydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 100mg, 10g, 2,5g.
2-N-propan-2-ylpyridine-2,5-diamine;dihydrochloride (CAS 1210765-92-6) is a chemical compound with the molecular formula C8H15Cl2N3 and a molecular weight of 224.13 g/mol. IUPAC name: 2-N-propan-2-ylpyridine-2,5-diamine;dihydrochloride. InChIKey: BDDGGYFYQLILRO-UHFFFAOYSA-N.
| Molecular formula | C8H15Cl2N3 |
|---|---|
| Molecular weight | 224.13 g/mol |
| IUPAC name | 2-N-propan-2-ylpyridine-2,5-diamine;dihydrochloride |
| InChIKey | BDDGGYFYQLILRO-UHFFFAOYSA-N |
| SMILES | CC(C)NC1=NC=C(C=C1)N.Cl.Cl |
Computed by PubChem (NCBI)