cas: 1970977-56-0 — see every product listed under this CAS number, including other names
3-(2,2,2-Trifluoro-1-hydroxyethyl)phenylboronic acid pinacol ester, 97%, 97% (CAS 1970977-56-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 50mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I4LE-100mg |
| cas | 1970977-56-0 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1058.00 Pln | |
| Chemat | 50mg | 650.00 Pln | |
| Chemat | 250mg | 1754.00 Pln | |
| Chemat | 1g | 4629.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,2,2-trifluoro-1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanol (CAS 1970977-56-0) is a chemical compound with the molecular formula C14H18BF3O3 and a molecular weight of 302.10 g/mol. IUPAC name: 2,2,2-trifluoro-1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanol. InChIKey: CDSZJUQQHUHGLH-UHFFFAOYSA-N.
| Molecular formula | C14H18BF3O3 |
|---|---|
| Molecular weight | 302.10 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanol |
| InChIKey | CDSZJUQQHUHGLH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C(C(F)(F)F)O |
Computed by PubChem (NCBI)