cas: 207742-85-6 — see every product listed under this CAS number, including other names
3-(2,3,4-Trifluorophenyl)acrylic acid 95% (E) (CAS 207742-85-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A406125-250mg |
| cas | 207742-85-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 236.88 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1238.12 Pln | |
| Ambeed | 25g | 4809.25 Pln |
| purity | 95% (E) |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A406125 |
3-(2,3,4-trifluorophenyl)prop-2-enoic acid (CAS 207742-85-6) is a chemical compound with the molecular formula C9H5F3O2 and a molecular weight of 202.13 g/mol. IUPAC name: 3-(2,3,4-trifluorophenyl)prop-2-enoic acid. InChIKey: AYDLBRHSHLRVAH-UHFFFAOYSA-N.
| Molecular formula | C9H5F3O2 |
|---|---|
| Molecular weight | 202.13 g/mol |
| IUPAC name | 3-(2,3,4-trifluorophenyl)prop-2-enoic acid |
| InChIKey | AYDLBRHSHLRVAH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C=CC(=O)O)F)F)F |
Computed by PubChem (NCBI)