cas: 207742-85-6 — see every product listed under this CAS number, including other names
3-(2,3,4-Trifluorophenyl)acrylic acid, 98%, 98% (CAS 207742-85-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113J03-100mg |
| cas | 207742-85-6 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 98.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-(2,3,4-trifluorophenyl)prop-2-enoic acid (CAS 207742-85-6) is a chemical compound with the molecular formula C9H5F3O2 and a molecular weight of 202.13 g/mol. IUPAC name: 3-(2,3,4-trifluorophenyl)prop-2-enoic acid. InChIKey: AYDLBRHSHLRVAH-UHFFFAOYSA-N.
| Molecular formula | C9H5F3O2 |
|---|---|
| Molecular weight | 202.13 g/mol |
| IUPAC name | 3-(2,3,4-trifluorophenyl)prop-2-enoic acid |
| InChIKey | AYDLBRHSHLRVAH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C=CC(=O)O)F)F)F |
Computed by PubChem (NCBI)