3-(2,3,4-Trimethoxyphenyl)propanoic acid, 98+%
cas: 33130-04-0 — see every product listed under this CAS number, including other names
3-(2,3,4-Trimethoxyphenyl)propanoic acid, 98+% (CAS 33130-04-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A348342-250mg |
| cas | 33130-04-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 170.12 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 915.50 Pln | |
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 309.20 Pln | |
| Chemat | 5g | 918.80 Pln | |
| BLDpharm | 250mg | 181.07 Pln | |
| BLDpharm | 1g | 347.68 Pln | |
| BLDpharm | 5g | 980.79 Pln | |
| Fluorochem | 250mg | 258.26 Pln | |
| Fluorochem | 1g | 549.82 Pln | |
| Fluorochem | 5g | 1695.25 Pln |
properties
| purity | 98+% |
|---|---|
| delivery time | 2-3 weeks |
3-(2,3,4-trimethoxyphenyl)propanoic acid (CAS 33130-04-0) is a chemical compound with the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. IUPAC name: 3-(2,3,4-trimethoxyphenyl)propanoic acid. InChIKey: QOPNYPCVRBRZOP-UHFFFAOYSA-N.
| Molecular formula | C12H16O5 |
|---|---|
| Molecular weight | 240.25 g/mol |
| IUPAC name | 3-(2,3,4-trimethoxyphenyl)propanoic acid |
| InChIKey | QOPNYPCVRBRZOP-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)CCC(=O)O)OC)OC |
Computed by PubChem (NCBI)
Synonyms:
3-(2,3,4-Trimethoxyphenyl)propionic acid, Benzenepropanoic acid, 2,3,4-trimethoxy-, 3-(2,3,4-Trimethoxyphenyl)propanoic acid, beta-(2,3,4-Trimethoxyphenyl)propionic acid, 3-(2,3,4-Trimethoxyphenyl)propanoicacid, QOPNYPCVRBRZOP-UHFFFAOYSA-, 3-(2,3,4-Trimethoxyphenyl)propanoic acid #, 3-(2,3,4-trimethoxyphenyl)propanoic acid acid, 3-(2,3,4-Trimethoxyphenyl)propionicacid,97%, .beta.-(2,3,4-Trimethoxy phenyl)propionic acid