CAS 33130-04-0 appears in our catalog under these names: 3-(2,3,4-trimethoxyphenyl)propanoic acid, 3-(2,3,4-Trimethoxyphenyl)propanoic acid, 98+%, 98+%, 3-(2,3,4-Trimethoxyphenyl)propanoic acid, 95%, 3-(2,3,4-Trimethoxyphenyl)propanoic acid, 98+%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 10g, 50g, 100g, 250mg, 1g, 5g.
3-(2,3,4-trimethoxyphenyl)propanoic acid (CAS 33130-04-0) is a chemical compound with the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. IUPAC name: 3-(2,3,4-trimethoxyphenyl)propanoic acid. InChIKey: QOPNYPCVRBRZOP-UHFFFAOYSA-N.
| Molecular formula | C12H16O5 |
|---|---|
| Molecular weight | 240.25 g/mol |
| IUPAC name | 3-(2,3,4-trimethoxyphenyl)propanoic acid |
| InChIKey | QOPNYPCVRBRZOP-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)CCC(=O)O)OC)OC |
Computed by PubChem (NCBI)