cas: 154258-67-0 — see every product listed under this CAS number, including other names
3-(2,4-Dimethylphenyl)-1H-pyrazole, 95%, 95% (CAS 154258-67-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11JW57-100mg |
| cas | 154258-67-0 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 405.20 Pln | |
| Chemat | 1g | 750.80 Pln | |
| Chemat | 5g | 2128.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-(2,4-dimethylphenyl)-1H-pyrazole (CAS 154258-67-0) is a chemical compound with the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. IUPAC name: 5-(2,4-dimethylphenyl)-1H-pyrazole. InChIKey: UKEFGCQNAHGBTE-UHFFFAOYSA-N.
| Molecular formula | C11H12N2 |
|---|---|
| Molecular weight | 172.23 g/mol |
| IUPAC name | 5-(2,4-dimethylphenyl)-1H-pyrazole |
| InChIKey | UKEFGCQNAHGBTE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C2=CC=NN2)C |
Computed by PubChem (NCBI)