CAS 948292-64-6 appears in our catalog under these names: 4-Amino-5,7-dimethylquinoline, 95%, 5,7-Dimethylquinolin-4-amine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
5,7-dimethylquinolin-4-amine (CAS 948292-64-6) is a chemical compound with the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. IUPAC name: 5,7-dimethylquinolin-4-amine. InChIKey: FZSRMFQWMZKGCM-UHFFFAOYSA-N.
| Molecular formula | C11H12N2 |
|---|---|
| Molecular weight | 172.23 g/mol |
| IUPAC name | 5,7-dimethylquinolin-4-amine |
| InChIKey | FZSRMFQWMZKGCM-UHFFFAOYSA-N |
| SMILES | CC1=CC2=NC=CC(=C2C(=C1)C)N |
Computed by PubChem (NCBI)