CAS 929339-38-8 is the registry number for 4-Amino-6,8-dimethylquinoline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
6,8-dimethylquinolin-4-amine (CAS 929339-38-8) is a chemical compound with the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. IUPAC name: 6,8-dimethylquinolin-4-amine. InChIKey: MWEAEUSVMYYGPK-UHFFFAOYSA-N.
| Molecular formula | C11H12N2 |
|---|---|
| Molecular weight | 172.23 g/mol |
| IUPAC name | 6,8-dimethylquinolin-4-amine |
| InChIKey | MWEAEUSVMYYGPK-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=CN=C2C(=C1)C)N |
Computed by PubChem (NCBI)