CAS 342618-57-9 appears in our catalog under these names: 4-Amino-2,6-dimethylquinoline, 95%, 2,6-Dimethylquinolin-4-amine, 98%, 4-Amino-2,6-dimethylquinoline, 95%, 95%, 2,6-Dimethylquinolin-4-amine, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
2,6-dimethylquinolin-4-amine (CAS 342618-57-9) is a chemical compound with the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. IUPAC name: 2,6-dimethylquinolin-4-amine. InChIKey: QWIFPURWTSVNGN-UHFFFAOYSA-N.
| Molecular formula | C11H12N2 |
|---|---|
| Molecular weight | 172.23 g/mol |
| IUPAC name | 2,6-dimethylquinolin-4-amine |
| InChIKey | QWIFPURWTSVNGN-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C(N=C2C=C1)C)N |
Computed by PubChem (NCBI)