Products 18226-50-1
CAS 18226-50-1 is the registry number for (2Z)-3-(Dimethylamino)-2-phenylprop-2-enenitrile, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 100g, 5g.
(Z)-3-(dimethylamino)-2-phenylprop-2-enenitrile (CAS 18226-50-1) is a chemical compound with the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. IUPAC name: (Z)-3-(dimethylamino)-2-phenylprop-2-enenitrile. InChIKey: VDKZGONUAHUVJF-PKNBQFBNSA-N.
| Molecular formula | C11H12N2 |
|---|---|
| Molecular weight | 172.23 g/mol |
| IUPAC name | (Z)-3-(dimethylamino)-2-phenylprop-2-enenitrile |
| InChIKey | VDKZGONUAHUVJF-PKNBQFBNSA-N |
| SMILES | CN(C)/C=C(\C#N)/C1=CC=CC=C1 |
Computed by PubChem (NCBI)