cas: 130408-15-0 — see every product listed under this CAS number, including other names
3-(2,5-Difluorophenyl)propanoic acid 98% (CAS 130408-15-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A103053-1g |
| cas | 130408-15-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 464.94 Pln | |
| Ambeed | 25g | 1416.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A103053 |
3-(2,5-difluorophenyl)propanoic acid (CAS 130408-15-0) is a chemical compound with the molecular formula C9H8F2O2 and a molecular weight of 186.15 g/mol. IUPAC name: 3-(2,5-difluorophenyl)propanoic acid. InChIKey: DURXQDAFKSWAES-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O2 |
|---|---|
| Molecular weight | 186.15 g/mol |
| IUPAC name | 3-(2,5-difluorophenyl)propanoic acid |
| InChIKey | DURXQDAFKSWAES-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)CCC(=O)O)F |
Computed by PubChem (NCBI)