Products 1206593-23-8
CAS 1206593-23-8 appears in our catalog under these names: 2',6'-Difluoro-3'-methoxyacetophenone, 95%, 1-(2,6-Difluoro-3-methoxyphenyl)ethanone, 95+%, 2',6'-Difluoro-3'-methoxyacetophenone. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 5g, 10g.
1-(2,6-difluoro-3-methoxyphenyl)ethanone (CAS 1206593-23-8) is a chemical compound with the molecular formula C9H8F2O2 and a molecular weight of 186.15 g/mol. IUPAC name: 1-(2,6-difluoro-3-methoxyphenyl)ethanone. InChIKey: ABYCRPRVOGSMLF-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O2 |
|---|---|
| Molecular weight | 186.15 g/mol |
| IUPAC name | 1-(2,6-difluoro-3-methoxyphenyl)ethanone |
| InChIKey | ABYCRPRVOGSMLF-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC(=C1F)OC)F |
Computed by PubChem (NCBI)