Products 130408-15-0
CAS 130408-15-0 appears in our catalog under these names: 3-(2,5-Difluorophenyl)propanoic acid, 95%, 3-(2,5-Difluorophenyl)propanoic acid, 3-(2,5-Difluorophenyl)propanoic acid 98%, 3-(2,5-Difluorophenyl)propanoic acid, 98%, 98%, 3-(2,5-Difluorophenyl)propanoic acid, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100mg, 250mg.
3-(2,5-difluorophenyl)propanoic acid (CAS 130408-15-0) is a chemical compound with the molecular formula C9H8F2O2 and a molecular weight of 186.15 g/mol. IUPAC name: 3-(2,5-difluorophenyl)propanoic acid. InChIKey: DURXQDAFKSWAES-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O2 |
|---|---|
| Molecular weight | 186.15 g/mol |
| IUPAC name | 3-(2,5-difluorophenyl)propanoic acid |
| InChIKey | DURXQDAFKSWAES-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)CCC(=O)O)F |
Computed by PubChem (NCBI)
Synonyms:
3-(2,5-Difluorophenyl)propanoic acid, Benzenepropanoic acid, 2,5-difluoro-, 2,5-Difluoro-benzenepropanoic acid, 3-(2,5-Difluorophenyl)propionic acid, 2,5-Difluorohydrocinnamic acid, 3-(2,5-difluorophenyl)-propionic acid, 2,5-difluoroBenzenepropanoic acid, 3-(2,5-Difluorophenyl)propanoicacid, 2,5-Difluorohydrocinnamic acid, 3-(2,5-Difluorophenyl)propanoic acid #