Products 167484-38-0
CAS 167484-38-0 appears in our catalog under these names: Methyl 2-(2,5-difluorophenyl)acetate, 98%, Methyl 2-(2,5-difluorophenyl)acetate, Methyl 2-(2,5-difluorophenyl)acetate 97%, Methyl 2-(2,5-difluorophenyl)acetate, 97%, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g, 50mg, 100mg.
Methyl 2-(2,5-difluorophenyl)acetate (CAS 167484-38-0) is a chemical compound with the molecular formula C9H8F2O2 and a molecular weight of 186.15 g/mol. IUPAC name: methyl 2-(2,5-difluorophenyl)acetate. InChIKey: PALKNABXMQMSGW-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O2 |
|---|---|
| Molecular weight | 186.15 g/mol |
| IUPAC name | methyl 2-(2,5-difluorophenyl)acetate |
| InChIKey | PALKNABXMQMSGW-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=C(C=CC(=C1)F)F |
Computed by PubChem (NCBI)