CAS 167684-02-8 appears in our catalog under these names: 6-Ethoxy-2,3-difluorobenzaldehyde, 95%, 6-Ethoxy-2,3-difluorobenzaldehyde, 98+%, 6-Ethoxy-2,3-difluorobenzaldehyde. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g.
6-ethoxy-2,3-difluorobenzaldehyde (CAS 167684-02-8) is a chemical compound with the molecular formula C9H8F2O2 and a molecular weight of 186.15 g/mol. IUPAC name: 6-ethoxy-2,3-difluorobenzaldehyde. InChIKey: AGFFKGUXHHUHOB-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O2 |
|---|---|
| Molecular weight | 186.15 g/mol |
| IUPAC name | 6-ethoxy-2,3-difluorobenzaldehyde |
| InChIKey | AGFFKGUXHHUHOB-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=C(C=C1)F)F)C=O |
Computed by PubChem (NCBI)