CAS 55620-18-3 appears in our catalog under these names: 3-(2-Acetoxyphenyl)acrylic acid, 95%, 95%, 3-(2-Acetoxyphenyl)acrylic acid, 97% (E), 2-Acetoxycinnamic acid, 95%, 2–Acetoxycinnamic Acid, 2-Acetylcoumaric acid. Offered by: Chemat, Ambeed, Combi-blocks, GLPBio, Biosynth. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g.
(E)-3-(2-acetyloxyphenyl)prop-2-enoic acid (CAS 55620-18-3) is a chemical compound with the molecular formula C11H10O4 and a molecular weight of 206.19 g/mol. IUPAC name: (E)-3-(2-acetyloxyphenyl)prop-2-enoic acid. InChIKey: UXOWQQCLBQBRMQ-VOTSOKGWSA-N.
| Molecular formula | C11H10O4 |
|---|---|
| Molecular weight | 206.19 g/mol |
| IUPAC name | (E)-3-(2-acetyloxyphenyl)prop-2-enoic acid |
| InChIKey | UXOWQQCLBQBRMQ-VOTSOKGWSA-N |
| SMILES | CC(=O)OC1=CC=CC=C1/C=C/C(=O)O |
Computed by PubChem (NCBI)