CAS 633282-39-0 appears in our catalog under these names: 3-Methyl-1-oxo-3,4-dihydro-1h-isochromene-3-carboxylic acid, 95%, 3-Methyl-1-oxoisochroman-3-carboxylic acid, 97%, 97%, 3-Methyl-1-oxo-3,4-dihydro-1H-isochromene-3-carboxylic acid, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250mg, 100mg.
3-methyl-1-oxo-4H-isochromene-3-carboxylic acid (CAS 633282-39-0) is a chemical compound with the molecular formula C11H10O4 and a molecular weight of 206.19 g/mol. IUPAC name: 3-methyl-1-oxo-4H-isochromene-3-carboxylic acid. InChIKey: XHMJBIRHDOBCBN-UHFFFAOYSA-N.
| Molecular formula | C11H10O4 |
|---|---|
| Molecular weight | 206.19 g/mol |
| IUPAC name | 3-methyl-1-oxo-4H-isochromene-3-carboxylic acid |
| InChIKey | XHMJBIRHDOBCBN-UHFFFAOYSA-N |
| SMILES | CC1(CC2=CC=CC=C2C(=O)O1)C(=O)O |
Computed by PubChem (NCBI)