CAS 41167-58-2 is the registry number for Methyl (2z)-2-hydroxy-4-oxo-4-phenylbut-2-enoate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
Methyl 4-hydroxy-2-oxo-4-phenyl-3-butenoate is an olefinic compound. It is functionally related to a cinnamic acid.
Source: ChEBI
| Molecular formula | C11H10O4 |
|---|---|
| Molecular weight | 206.19 g/mol |
| IUPAC name | methyl 4-hydroxy-2-oxo-4-phenylbut-3-enoate |
| InChIKey | RLRGETOSWKYBHX-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)C=C(C1=CC=CC=C1)O |
Computed by PubChem (NCBI)